Phospho-TAOK1/2/3(S181+S181+S177) Rabbit Monoclonal Antibody
Konjugasyon: Unconjugated
Recombinant rabbit monoclonal antibody
Uygulama
Reaktivite
Human,Mouse,Rat
Gen Adı
Phospho-TAOK1/2/3(S181+S181+S177)
Saklama
Aliquot and store at -20°C (valid for 12 months). Avoid freeze/thaw cycles.
Özet
| Ürün Adı | Phospho-TAOK1/2/3(S181+S181+S177) Rabbit Monoclonal Antibody |
| Açıklama | Recombinant rabbit monoclonal antibody |
| Konak | Rabbit |
| Reaktivite | Human,Mouse,Rat |
| Konjugasyon | Unconjugated |
| Modifikasyon | Phosphorylated |
| İzotip | IgG |
| Klonalite | Monoclonal |
| Form | Liquid |
| Konsantrasyon | Unconjugated |
| Saklama | Aliquot and store at -20°C (valid for 12 months). Avoid freeze/thaw cycles. |
| Nakliye | Ice bags. |
| Tampon | Purified antibody in PBS with 0.05% sodium azide,0.05% protective protein and 50% glycerol. |
| Saflaştırma | Affinity Purification |
Antijen Bilgisi
| Gen Adı | Phospho-TAOK1/2/3(S181+S181+S177) |
| Alternatif İsimler | TAOK1; TAOK2; TAOK3;;p-TAOK 1/2/3 (S181/S181/S177) |
| Gen Kimliği | - |
| SwissProt Kimliği | Q7L7X3/Q9UL54/Q9H2K8 |
| İmmünojen | A synthesized peptide derived from human TAOK 1/2/3 around the phosphorylation site of S181/S181/S177 |
Uygulama
| Uygulama | WB,IHC |
| Seyreltme Oranı | WB 1:1000-1:2000,IHC 1:100-1:200 |
| Moleküler Ağırlık | Calculated MW: 116 kDa ; Observed MW: 110,130,140 kDa |
Araştırma Alanı
Arka Plan
| Serine/threonine-protein kinase involved in various processes such as p38/MAPK14 stress-activated MAPK cascade, DNA damage response and regulation of cytoskeleton stability. Phosphorylates MAP2K3, MAP2K6 and MARK2. Acts as an activator of the p38/MAPK14 stress-activated MAPK cascade by mediating phosphorylation and subsequent activation of the upstream MAP2K3 and MAP2K6 kinases. Involved in G-protein coupled receptor signaling to p38/MAPK14. |
